C12H12IN3 — CID 66342395
N-(2,6-dimethylphenyl)-5-iodopyrimidin-4-amine (PubChem CID 66342395) has the molecular formula C12H12IN3 and a molecular weight of 325.15 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-5-iodopyrimidin-4-amine.
| Compound Name | N-(2,6-dimethylphenyl)-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 66342395 |
| Molecular Formula | C12H12IN3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-(2,6-dimethylphenyl)-5-iodopyrimidin-4-amine |
| SMILES | Cc1cccc(C)c1Nc1ncncc1I |
| InChI | InChI=1S/C12H12IN3/c1-8-4-3-5-9(2)11(8)16-12-10(13)6-14-7-15-12/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | CXKFPOSUZZVYQH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|