C12H13IN4 — CID 103110845
N-[(3-amino-2-methylphenyl)methyl]-5-iodopyrimidin-4-amine (PubChem CID 103110845) has the molecular formula C12H13IN4 and a molecular weight of 340.17 g/mol. Its IUPAC name is N-[(3-amino-2-methylphenyl)methyl]-5-iodopyrimidin-4-amine.
| Compound Name | N-[(3-amino-2-methylphenyl)methyl]-5-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 103110845 |
| Molecular Formula | C12H13IN4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-[(3-amino-2-methylphenyl)methyl]-5-iodopyrimidin-4-amine |
| SMILES | Cc1c(N)cccc1CNc1ncncc1I |
| InChI | InChI=1S/C12H13IN4/c1-8-9(3-2-4-11(8)14)5-16-12-10(13)6-15-7-17-12/h2-4,6-7H,5,14H2,1H3,(H,15,16,17) |
| InChIKey | LZNDHHZFSXHAKL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|