C13H14IN3O — CID 66342329
5-iodo-N-[[3-(methoxymethyl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 66342329) has the molecular formula C13H14IN3O and a molecular weight of 355.18 g/mol. Its IUPAC name is 5-iodo-N-[[3-(methoxymethyl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 5-iodo-N-[[3-(methoxymethyl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66342329 |
| Molecular Formula | C13H14IN3O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 5-iodo-N-[[3-(methoxymethyl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | COCc1cccc(CNc2ncncc2I)c1 |
| InChI | InChI=1S/C13H14IN3O/c1-18-8-11-4-2-3-10(5-11)6-16-13-12(14)7-15-9-17-13/h2-5,7,9H,6,8H2,1H3,(H,15,16,17) |
| InChIKey | GDXBDQVJOXERJX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|