C15H17BrN2O — CID 106875542
3-bromo-N-[[3-(methoxymethyl)phenyl]methyl]-4-methylpyridin-2-amine (PubChem CID 106875542) has the molecular formula C15H17BrN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is 3-bromo-N-[[3-(methoxymethyl)phenyl]methyl]-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-[[3-(methoxymethyl)phenyl]methyl]-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106875542 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-bromo-N-[[3-(methoxymethyl)phenyl]methyl]-4-methylpyridin-2-amine |
| SMILES | COCc1cccc(CNc2nccc(C)c2Br)c1 |
| InChI | InChI=1S/C15H17BrN2O/c1-11-6-7-17-15(14(11)16)18-9-12-4-3-5-13(8-12)10-19-2/h3-8H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | VQVIPHMIIJUBJL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |