C13H16N4O — CID 113228936
3-N-[[3-(methoxymethyl)phenyl]methyl]pyrazine-2,3-diamine (PubChem CID 113228936) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-N-[[3-(methoxymethyl)phenyl]methyl]pyrazine-2,3-diamine.
| Compound Name | 3-N-[[3-(methoxymethyl)phenyl]methyl]pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 113228936 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-N-[[3-(methoxymethyl)phenyl]methyl]pyrazine-2,3-diamine |
| SMILES | COCc1cccc(CNc2nccnc2N)c1 |
| InChI | InChI=1S/C13H16N4O/c1-18-9-11-4-2-3-10(7-11)8-17-13-12(14)15-5-6-16-13/h2-7H,8-9H2,1H3,(H2,14,15)(H,16,17) |
| InChIKey | MQDSVFIXCSMYFV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |