C13H23ClO2 — CID 66343413
2-[(3-chloro-2,2-diethylcyclobutyl)oxymethyl]oxolane (PubChem CID 66343413) has the molecular formula C13H23ClO2 and a molecular weight of 246.78 g/mol. Its IUPAC name is 2-[(3-chloro-2,2-diethylcyclobutyl)oxymethyl]oxolane.
| Compound Name | 2-[(3-chloro-2,2-diethylcyclobutyl)oxymethyl]oxolane |
|---|---|
| PubChem CID | 66343413 |
| Molecular Formula | C13H23ClO2 |
| Molecular Weight | 246.78 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-[(3-chloro-2,2-diethylcyclobutyl)oxymethyl]oxolane |
| SMILES | CCC1(CC)C(Cl)CC1OCC1CCCO1 |
| InChI | InChI=1S/C13H23ClO2/c1-3-13(4-2)11(14)8-12(13)16-9-10-6-5-7-15-10/h10-12H,3-9H2,1-2H3 |
| InChIKey | ZOHSKRXTCJZWJP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|