C11H19ClO2 — CID 66343624
2-[(3-chloro-2,2-dimethylcyclobutyl)oxymethyl]oxolane (PubChem CID 66343624) has the molecular formula C11H19ClO2 and a molecular weight of 218.72 g/mol. Its IUPAC name is 2-[(3-chloro-2,2-dimethylcyclobutyl)oxymethyl]oxolane.
| Compound Name | 2-[(3-chloro-2,2-dimethylcyclobutyl)oxymethyl]oxolane |
|---|---|
| PubChem CID | 66343624 |
| Molecular Formula | C11H19ClO2 |
| Molecular Weight | 218.72 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[(3-chloro-2,2-dimethylcyclobutyl)oxymethyl]oxolane |
| SMILES | CC1(C)C(Cl)CC1OCC1CCCO1 |
| InChI | InChI=1S/C11H19ClO2/c1-11(2)9(12)6-10(11)14-7-8-4-3-5-13-8/h8-10H,3-7H2,1-2H3 |
| InChIKey | YCSBTXDTULDYMU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.72 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|