C12H15BrN2O3 — CID 66344314
3-(3-bromo-2,2-dimethylcyclobutyl)oxy-6-methyl-2-nitropyridine (PubChem CID 66344314) has the molecular formula C12H15BrN2O3 and a molecular weight of 315.17 g/mol. Its IUPAC name is 3-(3-bromo-2,2-dimethylcyclobutyl)oxy-6-methyl-2-nitropyridine.
| Compound Name | 3-(3-bromo-2,2-dimethylcyclobutyl)oxy-6-methyl-2-nitropyridine |
|---|---|
| PubChem CID | 66344314 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 3-(3-bromo-2,2-dimethylcyclobutyl)oxy-6-methyl-2-nitropyridine |
| SMILES | Cc1ccc(OC2CC(Br)C2(C)C)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H15BrN2O3/c1-7-4-5-8(11(14-7)15(16)17)18-10-6-9(13)12(10,2)3/h4-5,9-10H,6H2,1-3H3 |
| InChIKey | LJLRPRMJKQQRDQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|