C16H17ClO — CID 66345692
1-(3-chloro-2,2-dimethylcyclobutyl)oxynaphthalene (PubChem CID 66345692) has the molecular formula C16H17ClO and a molecular weight of 260.76 g/mol. Its IUPAC name is 1-(3-chloro-2,2-dimethylcyclobutyl)oxynaphthalene.
| Compound Name | 1-(3-chloro-2,2-dimethylcyclobutyl)oxynaphthalene |
|---|---|
| PubChem CID | 66345692 |
| Molecular Formula | C16H17ClO |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(3-chloro-2,2-dimethylcyclobutyl)oxynaphthalene |
| SMILES | CC1(C)C(Cl)CC1Oc1cccc2ccccc12 |
| InChI | InChI=1S/C16H17ClO/c1-16(2)14(17)10-15(16)18-13-9-5-7-11-6-3-4-8-12(11)13/h3-9,14-15H,10H2,1-2H3 |
| InChIKey | FTJKDYSMJDCSMO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|