About 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene
1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene (PubChem CID 66345681) has the molecular formula C14H19ClO
and a molecular weight of 238.76 g/mol. Its IUPAC name is 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene |
| PubChem CID | 66345681 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(OC2CC(Cl)C2(C)C)c1 |
| InChI | InChI=1S/C14H19ClO/c1-9-5-10(2)7-11(6-9)16-13-8-12(15)14(13,3)4/h5-7,12-13H,8H2,1-4H3 |
| InChIKey | SXGVTSCSCPPDBN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene?
The IUPAC name of 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene (CID 66345681) is 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene.
What is the SMILES notation for 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene?
The canonical SMILES for 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene is Cc1cc(C)cc(OC2CC(Cl)C2(C)C)c1.
What is the InChIKey of 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene?
The InChIKey is SXGVTSCSCPPDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO/c1-9-5-10(2)7-11(6-9)16-13-8-12(15)14(13,3)4/h5-7,12-13H,8H2,1-4H3.
What are the key properties of 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene?
1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene has a molecular weight of 238.76 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-2,2-dimethylcyclobutyl)oxy-3,5-dimethylbenzene is sourced from PubChem (CID 66345681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).