C17H23BrO — CID 66345741
3-bromo-1-(2,3,5-trimethylphenoxy)spiro[3.4]octane (PubChem CID 66345741) has the molecular formula C17H23BrO and a molecular weight of 323.27 g/mol. Its IUPAC name is 3-bromo-1-(2,3,5-trimethylphenoxy)spiro[3.4]octane.
| Compound Name | 3-bromo-1-(2,3,5-trimethylphenoxy)spiro[3.4]octane |
|---|---|
| PubChem CID | 66345741 |
| Molecular Formula | C17H23BrO |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-bromo-1-(2,3,5-trimethylphenoxy)spiro[3.4]octane |
| SMILES | Cc1cc(C)c(C)c(OC2CC(Br)C23CCCC3)c1 |
| InChI | InChI=1S/C17H23BrO/c1-11-8-12(2)13(3)14(9-11)19-16-10-15(18)17(16)6-4-5-7-17/h8-9,15-16H,4-7,10H2,1-3H3 |
| InChIKey | XSBRLCOMAKSPDQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|