C15H17Br3O2 — CID 79403190
3-bromo-1-(2,5-dibromo-4-methoxyphenoxy)spiro[3.4]octane (PubChem CID 79403190) has the molecular formula C15H17Br3O2 and a molecular weight of 469.01 g/mol. Its IUPAC name is 3-bromo-1-(2,5-dibromo-4-methoxyphenoxy)spiro[3.4]octane.
| Compound Name | 3-bromo-1-(2,5-dibromo-4-methoxyphenoxy)spiro[3.4]octane |
|---|---|
| PubChem CID | 79403190 |
| Molecular Formula | C15H17Br3O2 |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 465.88 |
| IUPAC Name | 3-bromo-1-(2,5-dibromo-4-methoxyphenoxy)spiro[3.4]octane |
| SMILES | COc1cc(Br)c(OC2CC(Br)C23CCCC3)cc1Br |
| InChI | InChI=1S/C15H17Br3O2/c1-19-11-6-10(17)12(7-9(11)16)20-14-8-13(18)15(14)4-2-3-5-15/h6-7,13-14H,2-5,8H2,1H3 |
| InChIKey | UJZYEKSKOASFJO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|