C15H21ClO3S — CID 66345990
1-(3-chloro-2,2-diethylcyclobutyl)oxy-3-methylsulfonylbenzene (PubChem CID 66345990) has the molecular formula C15H21ClO3S and a molecular weight of 316.85 g/mol. Its IUPAC name is 1-(3-chloro-2,2-diethylcyclobutyl)oxy-3-methylsulfonylbenzene.
| Compound Name | 1-(3-chloro-2,2-diethylcyclobutyl)oxy-3-methylsulfonylbenzene |
|---|---|
| PubChem CID | 66345990 |
| Molecular Formula | C15H21ClO3S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-(3-chloro-2,2-diethylcyclobutyl)oxy-3-methylsulfonylbenzene |
| SMILES | CCC1(CC)C(Cl)CC1Oc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H21ClO3S/c1-4-15(5-2)13(16)10-14(15)19-11-7-6-8-12(9-11)20(3,17)18/h6-9,13-14H,4-5,10H2,1-3H3 |
| InChIKey | ZRUFWCRGIAHIQX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|