C12H14BrNO3 — CID 66346117
1-(3-bromo-2,2-dimethylcyclobutyl)oxy-3-nitrobenzene (PubChem CID 66346117) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 1-(3-bromo-2,2-dimethylcyclobutyl)oxy-3-nitrobenzene.
| Compound Name | 1-(3-bromo-2,2-dimethylcyclobutyl)oxy-3-nitrobenzene |
|---|---|
| PubChem CID | 66346117 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 1-(3-bromo-2,2-dimethylcyclobutyl)oxy-3-nitrobenzene |
| SMILES | CC1(C)C(Br)CC1Oc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14BrNO3/c1-12(2)10(13)7-11(12)17-9-5-3-4-8(6-9)14(15)16/h3-6,10-11H,7H2,1-2H3 |
| InChIKey | RVRTYOCLTHPIOR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|