C16H23N3S — CID 66347289
N-[[3-[(1-ethylimidazol-2-yl)methylsulfanyl]phenyl]methyl]propan-1-amine (PubChem CID 66347289) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is N-[[3-[(1-ethylimidazol-2-yl)methylsulfanyl]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-[(1-ethylimidazol-2-yl)methylsulfanyl]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66347289 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-[[3-[(1-ethylimidazol-2-yl)methylsulfanyl]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(SCc2nccn2CC)c1 |
| InChI | InChI=1S/C16H23N3S/c1-3-8-17-12-14-6-5-7-15(11-14)20-13-16-18-9-10-19(16)4-2/h5-7,9-11,17H,3-4,8,12-13H2,1-2H3 |
| InChIKey | YPAZPPFXFWZJJL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|