C14H18N2S2 — CID 66348256
N-[[3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methyl]propan-1-amine (PubChem CID 66348256) has the molecular formula C14H18N2S2 and a molecular weight of 278.45 g/mol. Its IUPAC name is N-[[3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66348256 |
| Molecular Formula | C14H18N2S2 |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[[3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc(SCc2cscn2)c1 |
| InChI | InChI=1S/C14H18N2S2/c1-2-6-15-8-12-4-3-5-14(7-12)18-10-13-9-17-11-16-13/h3-5,7,9,11,15H,2,6,8,10H2,1H3 |
| InChIKey | CDWXTARBTZMPAL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|