About [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine
[3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine (PubChem CID 66353488) has the molecular formula C11H12N2S2
and a molecular weight of 236.37 g/mol. Its IUPAC name is [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine |
| PubChem CID | 66353488 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.37 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine |
| SMILES | NCc1cccc(SCc2cscn2)c1 |
| InChI | InChI=1S/C11H12N2S2/c12-5-9-2-1-3-11(4-9)15-7-10-6-14-8-13-10/h1-4,6,8H,5,7,12H2 |
| InChIKey | HBSPRWMLZNXFIR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine?
The IUPAC name of [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine (CID 66353488) is [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine.
What is the SMILES notation for [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine?
The canonical SMILES for [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine is NCc1cccc(SCc2cscn2)c1.
What is the InChIKey of [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine?
The InChIKey is HBSPRWMLZNXFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S2/c12-5-9-2-1-3-11(4-9)15-7-10-6-14-8-13-10/h1-4,6,8H,5,7,12H2.
What are the key properties of [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine?
[3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine has a molecular weight of 236.37 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-thiazol-4-ylmethylsulfanyl)phenyl]methanamine is sourced from PubChem (CID 66353488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).