C18H15NS — CID 66350154
N-(9,10-dihydroanthracen-9-yl)thiophen-3-amine (PubChem CID 66350154) has the molecular formula C18H15NS and a molecular weight of 277.39 g/mol. Its IUPAC name is N-(9,10-dihydroanthracen-9-yl)thiophen-3-amine.
| Compound Name | N-(9,10-dihydroanthracen-9-yl)thiophen-3-amine |
|---|---|
| PubChem CID | 66350154 |
| Molecular Formula | C18H15NS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(9,10-dihydroanthracen-9-yl)thiophen-3-amine |
| SMILES | c1ccc2c(c1)Cc1ccccc1C2Nc1ccsc1 |
| InChI | InChI=1S/C18H15NS/c1-3-7-16-13(5-1)11-14-6-2-4-8-17(14)18(16)19-15-9-10-20-12-15/h1-10,12,18-19H,11H2 |
| InChIKey | ZKKIAGPBXAHTPN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |