C8H10N4S — CID 66350590
N-[(1-methyltriazol-4-yl)methyl]thiophen-3-amine (PubChem CID 66350590) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is N-[(1-methyltriazol-4-yl)methyl]thiophen-3-amine.
| Compound Name | N-[(1-methyltriazol-4-yl)methyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66350590 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | N-[(1-methyltriazol-4-yl)methyl]thiophen-3-amine |
| SMILES | Cn1cc(CNc2ccsc2)nn1 |
| InChI | InChI=1S/C8H10N4S/c1-12-5-8(10-11-12)4-9-7-2-3-13-6-7/h2-3,5-6,9H,4H2,1H3 |
| InChIKey | BWVLTOGWIZJNHP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |