C13H21N5S — CID 62421399
2-[4-(ethylaminomethyl)triazol-1-yl]-N-methyl-N-(thiophen-3-ylmethyl)ethanamine (PubChem CID 62421399) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-[4-(ethylaminomethyl)triazol-1-yl]-N-methyl-N-(thiophen-3-ylmethyl)ethanamine.
| Compound Name | 2-[4-(ethylaminomethyl)triazol-1-yl]-N-methyl-N-(thiophen-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62421399 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[4-(ethylaminomethyl)triazol-1-yl]-N-methyl-N-(thiophen-3-ylmethyl)ethanamine |
| SMILES | CCNCc1cn(CCN(C)Cc2ccsc2)nn1 |
| InChI | InChI=1S/C13H21N5S/c1-3-14-8-13-10-18(16-15-13)6-5-17(2)9-12-4-7-19-11-12/h4,7,10-11,14H,3,5-6,8-9H2,1-2H3 |
| InChIKey | OJTARMSOTOCTRU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |