C16H24N2O3 — CID 66352230
3-(2,5-dimethyl-4-nitrophenoxy)-2,2-diethylcyclobutan-1-amine (PubChem CID 66352230) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-(2,5-dimethyl-4-nitrophenoxy)-2,2-diethylcyclobutan-1-amine.
| Compound Name | 3-(2,5-dimethyl-4-nitrophenoxy)-2,2-diethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 66352230 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-(2,5-dimethyl-4-nitrophenoxy)-2,2-diethylcyclobutan-1-amine |
| SMILES | CCC1(CC)C(N)CC1Oc1cc(C)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H24N2O3/c1-5-16(6-2)14(17)9-15(16)21-13-8-10(3)12(18(19)20)7-11(13)4/h7-8,14-15H,5-6,9,17H2,1-4H3 |
| InChIKey | YMRHCGSIXPTLOF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|