C15H17NOS — CID 66352292
N-[3-(4-methoxyphenyl)cyclobutyl]thiophen-3-amine (PubChem CID 66352292) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)cyclobutyl]thiophen-3-amine.
| Compound Name | N-[3-(4-methoxyphenyl)cyclobutyl]thiophen-3-amine |
|---|---|
| PubChem CID | 66352292 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[3-(4-methoxyphenyl)cyclobutyl]thiophen-3-amine |
| SMILES | COc1ccc(C2CC(Nc3ccsc3)C2)cc1 |
| InChI | InChI=1S/C15H17NOS/c1-17-15-4-2-11(3-5-15)12-8-14(9-12)16-13-6-7-18-10-13/h2-7,10,12,14,16H,8-9H2,1H3 |
| InChIKey | RNSFOTKGBQIGIM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |