C17H17F2NO — CID 43633870
3,5-difluoro-N-[3-(4-methoxyphenyl)cyclobutyl]aniline (PubChem CID 43633870) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is 3,5-difluoro-N-[3-(4-methoxyphenyl)cyclobutyl]aniline.
| Compound Name | 3,5-difluoro-N-[3-(4-methoxyphenyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 43633870 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3,5-difluoro-N-[3-(4-methoxyphenyl)cyclobutyl]aniline |
| SMILES | COc1ccc(C2CC(Nc3cc(F)cc(F)c3)C2)cc1 |
| InChI | InChI=1S/C17H17F2NO/c1-21-17-4-2-11(3-5-17)12-6-15(7-12)20-16-9-13(18)8-14(19)10-16/h2-5,8-10,12,15,20H,6-7H2,1H3 |
| InChIKey | CLEQHKNVVALONL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |