C17H22N2S — CID 66355212
5-ethyl-5-methyl-2-phenyl-1-thiophen-3-ylpiperazine (PubChem CID 66355212) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 5-ethyl-5-methyl-2-phenyl-1-thiophen-3-ylpiperazine.
| Compound Name | 5-ethyl-5-methyl-2-phenyl-1-thiophen-3-ylpiperazine |
|---|---|
| PubChem CID | 66355212 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 5-ethyl-5-methyl-2-phenyl-1-thiophen-3-ylpiperazine |
| SMILES | CCC1(C)CN(c2ccsc2)C(c2ccccc2)CN1 |
| InChI | InChI=1S/C17H22N2S/c1-3-17(2)13-19(15-9-10-20-12-15)16(11-18-17)14-7-5-4-6-8-14/h4-10,12,16,18H,3,11,13H2,1-2H3 |
| InChIKey | HCALFONGLJFWCY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |