C17H25Cl2NO — CID 66357264
3-(2,6-dichlorophenoxy)-2,2-diethyl-N-propylcyclobutan-1-amine (PubChem CID 66357264) has the molecular formula C17H25Cl2NO and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-(2,6-dichlorophenoxy)-2,2-diethyl-N-propylcyclobutan-1-amine.
| Compound Name | 3-(2,6-dichlorophenoxy)-2,2-diethyl-N-propylcyclobutan-1-amine |
|---|---|
| PubChem CID | 66357264 |
| Molecular Formula | C17H25Cl2NO |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 3-(2,6-dichlorophenoxy)-2,2-diethyl-N-propylcyclobutan-1-amine |
| SMILES | CCCNC1CC(Oc2c(Cl)cccc2Cl)C1(CC)CC |
| InChI | InChI=1S/C17H25Cl2NO/c1-4-10-20-14-11-15(17(14,5-2)6-3)21-16-12(18)8-7-9-13(16)19/h7-9,14-15,20H,4-6,10-11H2,1-3H3 |
| InChIKey | OLJPROZVKRDXPI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |