C17H26INO — CID 66357441
2,2-diethyl-3-(3-iodophenoxy)-N-propylcyclobutan-1-amine (PubChem CID 66357441) has the molecular formula C17H26INO and a molecular weight of 387.31 g/mol. Its IUPAC name is 2,2-diethyl-3-(3-iodophenoxy)-N-propylcyclobutan-1-amine.
| Compound Name | 2,2-diethyl-3-(3-iodophenoxy)-N-propylcyclobutan-1-amine |
|---|---|
| PubChem CID | 66357441 |
| Molecular Formula | C17H26INO |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2,2-diethyl-3-(3-iodophenoxy)-N-propylcyclobutan-1-amine |
| SMILES | CCCNC1CC(Oc2cccc(I)c2)C1(CC)CC |
| InChI | InChI=1S/C17H26INO/c1-4-10-19-15-12-16(17(15,5-2)6-3)20-14-9-7-8-13(18)11-14/h7-9,11,15-16,19H,4-6,10,12H2,1-3H3 |
| InChIKey | DODYQRWAZKCNEI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|