C16H24FNO — CID 66358535
N,2,2-triethyl-3-(4-fluorophenoxy)cyclobutan-1-amine (PubChem CID 66358535) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is N,2,2-triethyl-3-(4-fluorophenoxy)cyclobutan-1-amine.
| Compound Name | N,2,2-triethyl-3-(4-fluorophenoxy)cyclobutan-1-amine |
|---|---|
| PubChem CID | 66358535 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N,2,2-triethyl-3-(4-fluorophenoxy)cyclobutan-1-amine |
| SMILES | CCNC1CC(Oc2ccc(F)cc2)C1(CC)CC |
| InChI | InChI=1S/C16H24FNO/c1-4-16(5-2)14(18-6-3)11-15(16)19-13-9-7-12(17)8-10-13/h7-10,14-15,18H,4-6,11H2,1-3H3 |
| InChIKey | UVZPRUVRQQQTAG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |