C13H12BrN3O3 — CID 66361233
4-bromo-1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-nitropyrazole (PubChem CID 66361233) has the molecular formula C13H12BrN3O3 and a molecular weight of 338.16 g/mol. Its IUPAC name is 4-bromo-1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-nitropyrazole.
| Compound Name | 4-bromo-1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-nitropyrazole |
|---|---|
| PubChem CID | 66361233 |
| Molecular Formula | C13H12BrN3O3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 4-bromo-1-[(5-methyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-nitropyrazole |
| SMILES | Cc1ccc2c(c1)CC(Cn1cc(Br)c([N+](=O)[O-])n1)O2 |
| InChI | InChI=1S/C13H12BrN3O3/c1-8-2-3-12-9(4-8)5-10(20-12)6-16-7-11(14)13(15-16)17(18)19/h2-4,7,10H,5-6H2,1H3 |
| InChIKey | AZDONCVISSYKGC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|