C10H12ClN3O2 — CID 66366543
4-chloro-6-(oxan-3-ylamino)pyrimidine-5-carbaldehyde (PubChem CID 66366543) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is 4-chloro-6-(oxan-3-ylamino)pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-(oxan-3-ylamino)pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 66366543 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 4-chloro-6-(oxan-3-ylamino)pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1c(Cl)ncnc1NC1CCCOC1 |
| InChI | InChI=1S/C10H12ClN3O2/c11-9-8(4-15)10(13-6-12-9)14-7-2-1-3-16-5-7/h4,6-7H,1-3,5H2,(H,12,13,14) |
| InChIKey | IBKDYYVUAKRNHW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|