C17H23ClO2 — CID 66367315
3-(4-chloro-3-methylphenoxy)spiro[3.6]decan-1-ol (PubChem CID 66367315) has the molecular formula C17H23ClO2 and a molecular weight of 294.82 g/mol. Its IUPAC name is 3-(4-chloro-3-methylphenoxy)spiro[3.6]decan-1-ol.
| Compound Name | 3-(4-chloro-3-methylphenoxy)spiro[3.6]decan-1-ol |
|---|---|
| PubChem CID | 66367315 |
| Molecular Formula | C17H23ClO2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-(4-chloro-3-methylphenoxy)spiro[3.6]decan-1-ol |
| SMILES | Cc1cc(OC2CC(O)C23CCCCCC3)ccc1Cl |
| InChI | InChI=1S/C17H23ClO2/c1-12-10-13(6-7-14(12)18)20-16-11-15(19)17(16)8-4-2-3-5-9-17/h6-7,10,15-16,19H,2-5,8-9,11H2,1H3 |
| InChIKey | HMZINYKVMKUDKO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |