About methyl 2-ethenoxybenzoate
methyl 2-ethenoxybenzoate (PubChem CID 66368826) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is methyl 2-ethenoxybenzoate.
Molecular Properties
| Compound Name | methyl 2-ethenoxybenzoate |
| PubChem CID | 66368826 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | methyl 2-ethenoxybenzoate |
| SMILES | C=COc1ccccc1C(=O)OC |
| InChI | InChI=1S/C10H10O3/c1-3-13-9-7-5-4-6-8(9)10(11)12-2/h3-7H,1H2,2H3 |
| InChIKey | REXWOVSLTYEHAO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethenoxybenzoate?
The IUPAC name of methyl 2-ethenoxybenzoate (CID 66368826) is methyl 2-ethenoxybenzoate.
What is the SMILES notation for methyl 2-ethenoxybenzoate?
The canonical SMILES for methyl 2-ethenoxybenzoate is C=COc1ccccc1C(=O)OC.
What is the InChIKey of methyl 2-ethenoxybenzoate?
The InChIKey is REXWOVSLTYEHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-3-13-9-7-5-4-6-8(9)10(11)12-2/h3-7H,1H2,2H3.
What are the key properties of methyl 2-ethenoxybenzoate?
methyl 2-ethenoxybenzoate has a molecular weight of 178.19 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethenoxybenzoate is sourced from PubChem (CID 66368826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).