C16H17FN2O2 — CID 66369348
[4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone (PubChem CID 66369348) has the molecular formula C16H17FN2O2 and a molecular weight of 288.32 g/mol. Its IUPAC name is [4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone.
| Compound Name | [4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone |
|---|---|
| PubChem CID | 66369348 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | [4-(3-aminoprop-1-ynyl)-2-fluorophenyl]-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)methanone |
| SMILES | NCC#Cc1ccc(C(=O)N2CC3CCC(C2)O3)c(F)c1 |
| InChI | InChI=1S/C16H17FN2O2/c17-15-8-11(2-1-7-18)3-6-14(15)16(20)19-9-12-4-5-13(10-19)21-12/h3,6,8,12-13H,4-5,7,9-10,18H2 |
| InChIKey | BIURHURCSJCUKS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|