C29H22Cl2F3N3O4 — CID 6637152
(3aR,7R,7aS)-7a-(4-chlorophenyl)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 6637152) has the molecular formula C29H22Cl2F3N3O4 and a molecular weight of 604.41 g/mol. Its IUPAC name is (3aR,7R,7aS)-7a-(4-chlorophenyl)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,7R,7aS)-7a-(4-chlorophenyl)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 6637152 |
| Molecular Formula | C29H22Cl2F3N3O4 |
| Molecular Weight | 604.41 g/mol |
| Exact Mass | 603.09 |
| IUPAC Name | (3aR,7R,7aS)-7a-(4-chlorophenyl)-2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)N(Nc3ncc(C(F)(F)F)cc3Cl)C(=O)[C@@]2(c2ccc(Cl)cc2)[C@H]1c1cccc(OC)c1O |
| InChI | InChI=1S/C29H22Cl2F3N3O4/c1-3-15-7-12-20-26(39)37(36-25-21(31)13-17(14-35-25)29(32,33)34)27(40)28(20,16-8-10-18(30)11-9-16)23(15)19-5-4-6-22(41-2)24(19)38/h3-11,13-14,20,23,38H,1,12H2,2H3,(H,35,36)/t20-,23+,28+/m0/s1 |
| InChIKey | IUNNZGFFTBJKNH-QHLUZPDOSA-N |
| XLogP | 6.67 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.41 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|