C30H26Cl2N2O5 — CID 6637309
(3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 6637309) has the molecular formula C30H26Cl2N2O5 and a molecular weight of 565.45 g/mol. Its IUPAC name is (3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 6637309 |
| Molecular Formula | C30H26Cl2N2O5 |
| Molecular Weight | 565.45 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | (3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(2-hydroxy-3-methoxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)N(Nc3ccc(Cl)cc3Cl)C(=O)[C@@]2(c2ccc(OC)cc2)[C@H]1c1cccc(OC)c1O |
| InChI | InChI=1S/C30H26Cl2N2O5/c1-4-17-8-14-22-28(36)34(33-24-15-11-19(31)16-23(24)32)29(37)30(22,18-9-12-20(38-2)13-10-18)26(17)21-6-5-7-25(39-3)27(21)35/h4-13,15-16,22,26,33,35H,1,14H2,2-3H3/t22-,26+,30+/m0/s1 |
| InChIKey | BZCVAZQKLRWVSU-ODTCIBSJSA-N |
| XLogP | 6.27 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.45 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|