C29H24Cl2N2O4 — CID 6637322
(3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(3-hydroxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 6637322) has the molecular formula C29H24Cl2N2O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is (3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(3-hydroxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(3-hydroxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 6637322 |
| Molecular Formula | C29H24Cl2N2O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | (3aR,7R,7aS)-2-(2,4-dichloroanilino)-6-ethenyl-7-(3-hydroxyphenyl)-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)N(Nc3ccc(Cl)cc3Cl)C(=O)[C@@]2(c2ccc(OC)cc2)[C@H]1c1cccc(O)c1 |
| InChI | InChI=1S/C29H24Cl2N2O4/c1-3-17-7-13-23-27(35)33(32-25-14-10-20(30)16-24(25)31)28(36)29(23,19-8-11-22(37-2)12-9-19)26(17)18-5-4-6-21(34)15-18/h3-12,14-16,23,26,32,34H,1,13H2,2H3/t23-,26+,29+/m0/s1 |
| InChIKey | YISTZXIZYJBDBU-SCWLSEGGSA-N |
| XLogP | 6.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|