C30H24Br2Cl2N2O5 — CID 6637337
(3aR,7S,7aS)-7-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 6637337) has the molecular formula C30H24Br2Cl2N2O5 and a molecular weight of 723.24 g/mol. Its IUPAC name is (3aR,7S,7aS)-7-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,7S,7aS)-7-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 6637337 |
| Molecular Formula | C30H24Br2Cl2N2O5 |
| Molecular Weight | 723.24 g/mol |
| Exact Mass | 719.94 |
| IUPAC Name | (3aR,7S,7aS)-7-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)N(Nc3ccc(Cl)cc3Cl)C(=O)[C@@]2(c2ccc(OC)cc2)[C@H]1c1cc(OC)c(O)c(Br)c1Br |
| InChI | InChI=1S/C30H24Br2Cl2N2O5/c1-4-15-5-11-20-28(38)36(35-22-12-8-17(33)13-21(22)34)29(39)30(20,16-6-9-18(40-2)10-7-16)24(15)19-14-23(41-3)27(37)26(32)25(19)31/h4-10,12-14,20,24,35,37H,1,11H2,2-3H3/t20-,24+,30+/m0/s1 |
| InChIKey | QVTLAZVSUUTFFE-HOZBAXTGSA-N |
| XLogP | 7.79 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.24 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|