C29H23Cl3N2O4 — CID 6637314
(3aR,7R,7aS)-7-(5-chloro-2-hydroxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 6637314) has the molecular formula C29H23Cl3N2O4 and a molecular weight of 569.87 g/mol. Its IUPAC name is (3aR,7R,7aS)-7-(5-chloro-2-hydroxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | (3aR,7R,7aS)-7-(5-chloro-2-hydroxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 6637314 |
| Molecular Formula | C29H23Cl3N2O4 |
| Molecular Weight | 569.87 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | (3aR,7R,7aS)-7-(5-chloro-2-hydroxyphenyl)-2-(2,4-dichloroanilino)-6-ethenyl-7a-(4-methoxyphenyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)N(Nc3ccc(Cl)cc3Cl)C(=O)[C@@]2(c2ccc(OC)cc2)[C@H]1c1cc(Cl)ccc1O |
| InChI | InChI=1S/C29H23Cl3N2O4/c1-3-16-4-11-22-27(36)34(33-24-12-7-19(31)15-23(24)32)28(37)29(22,17-5-9-20(38-2)10-6-17)26(16)21-14-18(30)8-13-25(21)35/h3-10,12-15,22,26,33,35H,1,11H2,2H3/t22-,26+,29+/m0/s1 |
| InChIKey | JUVISJUSOZKMAS-GZWANVBQSA-N |
| XLogP | 6.91 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.87 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|