C13H16ClNO3S — CID 66371637
3-[4-(chloromethyl)phenyl]sulfonyl-8-oxa-3-azabicyclo[3.2.1]octane (PubChem CID 66371637) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 3-[4-(chloromethyl)phenyl]sulfonyl-8-oxa-3-azabicyclo[3.2.1]octane.
| Compound Name | 3-[4-(chloromethyl)phenyl]sulfonyl-8-oxa-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 66371637 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-[4-(chloromethyl)phenyl]sulfonyl-8-oxa-3-azabicyclo[3.2.1]octane |
| SMILES | O=S(=O)(c1ccc(CCl)cc1)N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C13H16ClNO3S/c14-7-10-1-5-13(6-2-10)19(16,17)15-8-11-3-4-12(9-15)18-11/h1-2,5-6,11-12H,3-4,7-9H2 |
| InChIKey | CFPHRGFITWJBQD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|