C12H18N2O3S2 — CID 66371904
N-methyl-1-[3-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-2-yl]methanamine (PubChem CID 66371904) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-methyl-1-[3-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-2-yl]methanamine.
| Compound Name | N-methyl-1-[3-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 66371904 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-methyl-1-[3-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)thiophen-2-yl]methanamine |
| SMILES | CNCc1sccc1S(=O)(=O)N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C12H18N2O3S2/c1-13-6-11-12(4-5-18-11)19(15,16)14-7-9-2-3-10(8-14)17-9/h4-5,9-10,13H,2-3,6-8H2,1H3 |
| InChIKey | WCSRTVONLBBVLY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |