C13H12FN3O3S — CID 66374408
2-[2-[(2-amino-5-fluorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66374408) has the molecular formula C13H12FN3O3S and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[2-[(2-amino-5-fluorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(2-amino-5-fluorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66374408 |
| Molecular Formula | C13H12FN3O3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[2-[(2-amino-5-fluorobenzoyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Nc1ccc(F)cc1C(=O)NCCc1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H12FN3O3S/c14-7-1-2-9(15)8(5-7)12(18)16-4-3-11-17-10(6-21-11)13(19)20/h1-2,5-6H,3-4,15H2,(H,16,18)(H,19,20) |
| InChIKey | AKRZWMPEZXBXSE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|