C13H13F2N3OS — CID 107121045
3-amino-2,5-difluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 107121045) has the molecular formula C13H13F2N3OS and a molecular weight of 297.33 g/mol. Its IUPAC name is 3-amino-2,5-difluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 3-amino-2,5-difluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107121045 |
| Molecular Formula | C13H13F2N3OS |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-amino-2,5-difluoro-N-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | Cc1csc(CCNC(=O)c2cc(F)cc(N)c2F)n1 |
| InChI | InChI=1S/C13H13F2N3OS/c1-7-6-20-11(18-7)2-3-17-13(19)9-4-8(14)5-10(16)12(9)15/h4-6H,2-3,16H2,1H3,(H,17,19) |
| InChIKey | INXSZSZBAOAGTB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|