C12H10ClN3O4S — CID 66374507
2-[1-(4-chloro-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66374507) has the molecular formula C12H10ClN3O4S and a molecular weight of 327.75 g/mol. Its IUPAC name is 2-[1-(4-chloro-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-(4-chloro-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66374507 |
| Molecular Formula | C12H10ClN3O4S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-[1-(4-chloro-2-nitroanilino)ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(Nc1ccc(Cl)cc1[N+](=O)[O-])c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H10ClN3O4S/c1-6(11-15-9(5-21-11)12(17)18)14-8-3-2-7(13)4-10(8)16(19)20/h2-6,14H,1H3,(H,17,18) |
| InChIKey | BJHPVCUMZXJQDN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|