C21H22O4 — CID 6637549
(4aR,8R,8aS)-7-ethenyl-8-(2-hydroxy-3-methoxyphenyl)-2,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione (PubChem CID 6637549) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (4aR,8R,8aS)-7-ethenyl-8-(2-hydroxy-3-methoxyphenyl)-2,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione.
| Compound Name | (4aR,8R,8aS)-7-ethenyl-8-(2-hydroxy-3-methoxyphenyl)-2,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 6637549 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4aR,8R,8aS)-7-ethenyl-8-(2-hydroxy-3-methoxyphenyl)-2,8a-dimethyl-5,8-dihydro-4aH-naphthalene-1,4-dione |
| SMILES | C=CC1=CC[C@H]2C(=O)C=C(C)C(=O)[C@@]2(C)[C@H]1c1cccc(OC)c1O |
| InChI | InChI=1S/C21H22O4/c1-5-13-9-10-15-16(22)11-12(2)20(24)21(15,3)18(13)14-7-6-8-17(25-4)19(14)23/h5-9,11,15,18,23H,1,10H2,2-4H3/t15-,18+,21+/m0/s1 |
| InChIKey | VLDFDSXPNNTFML-RRMPHLOHSA-N |
| XLogP | 3.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |