C12H7I3N2O3S — CID 66379504
2-[[(2,3,5-triiodobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 66379504) has the molecular formula C12H7I3N2O3S and a molecular weight of 639.98 g/mol. Its IUPAC name is 2-[[(2,3,5-triiodobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[(2,3,5-triiodobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66379504 |
| Molecular Formula | C12H7I3N2O3S |
| Molecular Weight | 639.98 g/mol |
| Exact Mass | 639.73 |
| IUPAC Name | 2-[[(2,3,5-triiodobenzoyl)amino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(CNC(=O)c2cc(I)cc(I)c2I)n1 |
| InChI | InChI=1S/C12H7I3N2O3S/c13-5-1-6(10(15)7(14)2-5)11(18)16-3-9-17-8(4-21-9)12(19)20/h1-2,4H,3H2,(H,16,18)(H,19,20) |
| InChIKey | QPGMKGXLRZLJRI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.98 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|