C14H26N2O3S2 — CID 66382083
(3-methylsulfonylthiomorpholin-4-yl)-(4-propylpiperidin-4-yl)methanone (PubChem CID 66382083) has the molecular formula C14H26N2O3S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is (3-methylsulfonylthiomorpholin-4-yl)-(4-propylpiperidin-4-yl)methanone.
| Compound Name | (3-methylsulfonylthiomorpholin-4-yl)-(4-propylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 66382083 |
| Molecular Formula | C14H26N2O3S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (3-methylsulfonylthiomorpholin-4-yl)-(4-propylpiperidin-4-yl)methanone |
| SMILES | CCCC1(C(=O)N2CCSCC2S(C)(=O)=O)CCNCC1 |
| InChI | InChI=1S/C14H26N2O3S2/c1-3-4-14(5-7-15-8-6-14)13(17)16-9-10-20-11-12(16)21(2,18)19/h12,15H,3-11H2,1-2H3 |
| InChIKey | MRTBPWDGQOUPES-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |