C12H26N2O4S3 — CID 66383682
4-(3-methylsulfonylthiomorpholin-4-yl)sulfonyl-N-propan-2-ylbutan-1-amine (PubChem CID 66383682) has the molecular formula C12H26N2O4S3 and a molecular weight of 358.55 g/mol. Its IUPAC name is 4-(3-methylsulfonylthiomorpholin-4-yl)sulfonyl-N-propan-2-ylbutan-1-amine.
| Compound Name | 4-(3-methylsulfonylthiomorpholin-4-yl)sulfonyl-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 66383682 |
| Molecular Formula | C12H26N2O4S3 |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 4-(3-methylsulfonylthiomorpholin-4-yl)sulfonyl-N-propan-2-ylbutan-1-amine |
| SMILES | CC(C)NCCCCS(=O)(=O)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C12H26N2O4S3/c1-11(2)13-6-4-5-9-21(17,18)14-7-8-19-10-12(14)20(3,15)16/h11-13H,4-10H2,1-3H3 |
| InChIKey | OLJCSHVYXTXOEC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|