C14H21FN2O2S2 — CID 66383882
2-(3-ethylsulfonylthiomorpholin-4-yl)-2-(4-fluorophenyl)ethanamine (PubChem CID 66383882) has the molecular formula C14H21FN2O2S2 and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-(3-ethylsulfonylthiomorpholin-4-yl)-2-(4-fluorophenyl)ethanamine.
| Compound Name | 2-(3-ethylsulfonylthiomorpholin-4-yl)-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 66383882 |
| Molecular Formula | C14H21FN2O2S2 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(3-ethylsulfonylthiomorpholin-4-yl)-2-(4-fluorophenyl)ethanamine |
| SMILES | CCS(=O)(=O)C1CSCCN1C(CN)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2O2S2/c1-2-21(18,19)14-10-20-8-7-17(14)13(9-16)11-3-5-12(15)6-4-11/h3-6,13-14H,2,7-10,16H2,1H3 |
| InChIKey | ZFDNWLYADZXIFS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |