C13H18Cl2N2O2S2 — CID 66383925
2-(3,4-dichlorophenyl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine (PubChem CID 66383925) has the molecular formula C13H18Cl2N2O2S2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine.
| Compound Name | 2-(3,4-dichlorophenyl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 66383925 |
| Molecular Formula | C13H18Cl2N2O2S2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine |
| SMILES | CS(=O)(=O)C1CSCCN1C(CN)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O2S2/c1-21(18,19)13-8-20-5-4-17(13)12(7-16)9-2-3-10(14)11(15)6-9/h2-3,6,12-13H,4-5,7-8,16H2,1H3 |
| InChIKey | FPCOUSAQNGGONR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |