C11H17BrN2O2S3 — CID 66384487
2-(5-bromothiophen-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine (PubChem CID 66384487) has the molecular formula C11H17BrN2O2S3 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine.
| Compound Name | 2-(5-bromothiophen-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 66384487 |
| Molecular Formula | C11H17BrN2O2S3 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanamine |
| SMILES | CS(=O)(=O)C1CSCCN1C(CN)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H17BrN2O2S3/c1-19(15,16)11-7-17-5-4-14(11)8(6-13)9-2-3-10(12)18-9/h2-3,8,11H,4-7,13H2,1H3 |
| InChIKey | MHUZFKGROVSMRF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |