C11H12N2OS2 — CID 66385011
N-[2-[(thiophen-3-ylamino)methyl]thiophen-3-yl]acetamide (PubChem CID 66385011) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[2-[(thiophen-3-ylamino)methyl]thiophen-3-yl]acetamide.
| Compound Name | N-[2-[(thiophen-3-ylamino)methyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 66385011 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | N-[2-[(thiophen-3-ylamino)methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNc1ccsc1 |
| InChI | InChI=1S/C11H12N2OS2/c1-8(14)13-10-3-5-16-11(10)6-12-9-2-4-15-7-9/h2-5,7,12H,6H2,1H3,(H,13,14) |
| InChIKey | JWSIQEPKPQADMN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |